About 3-[(1,1-difluoropropan-2-ylamino)methyl]pentan-1-ol
3-[(1,1-difluoropropan-2-ylamino)methyl]pentan-1-ol (PubChem CID 102869776) has the molecular formula C9H19F2NO
and a molecular weight of 195.25 g/mol. Its IUPAC name is 3-[(1,1-difluoropropan-2-ylamino)methyl]pentan-1-ol.
Molecular Properties
| Compound Name | 3-[(1,1-difluoropropan-2-ylamino)methyl]pentan-1-ol |
| PubChem CID | 102869776 |
| Molecular Formula | C9H19F2NO |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 3-[(1,1-difluoropropan-2-ylamino)methyl]pentan-1-ol |
| SMILES | CCC(CCO)CNC(C)C(F)F |
| InChI | InChI=1S/C9H19F2NO/c1-3-8(4-5-13)6-12-7(2)9(10)11/h7-9,12-13H,3-6H2,1-2H3 |
| InChIKey | KNGLTEKWSRCFNS-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(1,1-difluoropropan-2-ylamino)methyl]pentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1,1-difluoropropan-2-ylamino)methyl]pentan-1-ol?
The IUPAC name of 3-[(1,1-difluoropropan-2-ylamino)methyl]pentan-1-ol (CID 102869776) is 3-[(1,1-difluoropropan-2-ylamino)methyl]pentan-1-ol.
What is the SMILES notation for 3-[(1,1-difluoropropan-2-ylamino)methyl]pentan-1-ol?
The canonical SMILES for 3-[(1,1-difluoropropan-2-ylamino)methyl]pentan-1-ol is CCC(CCO)CNC(C)C(F)F.
What is the InChIKey of 3-[(1,1-difluoropropan-2-ylamino)methyl]pentan-1-ol?
The InChIKey is KNGLTEKWSRCFNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19F2NO/c1-3-8(4-5-13)6-12-7(2)9(10)11/h7-9,12-13H,3-6H2,1-2H3.
What are the key properties of 3-[(1,1-difluoropropan-2-ylamino)methyl]pentan-1-ol?
3-[(1,1-difluoropropan-2-ylamino)methyl]pentan-1-ol has a molecular weight of 195.25 g/mol, XLogP of 1.64, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1,1-difluoropropan-2-ylamino)methyl]pentan-1-ol is sourced from PubChem (CID 102869776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).