C9H13F2NO — CID 102869882
1,1-difluoro-N-[(1R)-1-(furan-2-yl)ethyl]propan-2-amine (PubChem CID 102869882) has the molecular formula C9H13F2NO and a molecular weight of 189.21 g/mol. Its IUPAC name is 1,1-difluoro-N-[(1R)-1-(furan-2-yl)ethyl]propan-2-amine.
| Compound Name | 1,1-difluoro-N-[(1R)-1-(furan-2-yl)ethyl]propan-2-amine |
|---|---|
| PubChem CID | 102869882 |
| Molecular Formula | C9H13F2NO |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 1,1-difluoro-N-[(1R)-1-(furan-2-yl)ethyl]propan-2-amine |
| SMILES | CC(N[C@H](C)c1ccco1)C(F)F |
| InChI | InChI=1S/C9H13F2NO/c1-6(8-4-3-5-13-8)12-7(2)9(10)11/h3-7,9,12H,1-2H3/t6-,7?/m1/s1 |
| InChIKey | NMBWGHPAQPURMN-ULUSZKPHSA-N |
| XLogP | 2.58 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |