About [1-[(1,1-difluoropropan-2-ylamino)methyl]cyclopropyl]methanol
[1-[(1,1-difluoropropan-2-ylamino)methyl]cyclopropyl]methanol (PubChem CID 102869917) has the molecular formula C8H15F2NO
and a molecular weight of 179.21 g/mol. Its IUPAC name is [1-[(1,1-difluoropropan-2-ylamino)methyl]cyclopropyl]methanol.
Molecular Properties
| Compound Name | [1-[(1,1-difluoropropan-2-ylamino)methyl]cyclopropyl]methanol |
| PubChem CID | 102869917 |
| Molecular Formula | C8H15F2NO |
| Molecular Weight | 179.21 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | [1-[(1,1-difluoropropan-2-ylamino)methyl]cyclopropyl]methanol |
| SMILES | CC(NCC1(CO)CC1)C(F)F |
| InChI | InChI=1S/C8H15F2NO/c1-6(7(9)10)11-4-8(5-12)2-3-8/h6-7,11-12H,2-5H2,1H3 |
| InChIKey | XTKAXLXDFFZLMJ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.21 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [1-[(1,1-difluoropropan-2-ylamino)methyl]cyclopropyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(1,1-difluoropropan-2-ylamino)methyl]cyclopropyl]methanol?
The IUPAC name of [1-[(1,1-difluoropropan-2-ylamino)methyl]cyclopropyl]methanol (CID 102869917) is [1-[(1,1-difluoropropan-2-ylamino)methyl]cyclopropyl]methanol.
What is the SMILES notation for [1-[(1,1-difluoropropan-2-ylamino)methyl]cyclopropyl]methanol?
The canonical SMILES for [1-[(1,1-difluoropropan-2-ylamino)methyl]cyclopropyl]methanol is CC(NCC1(CO)CC1)C(F)F.
What is the InChIKey of [1-[(1,1-difluoropropan-2-ylamino)methyl]cyclopropyl]methanol?
The InChIKey is XTKAXLXDFFZLMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15F2NO/c1-6(7(9)10)11-4-8(5-12)2-3-8/h6-7,11-12H,2-5H2,1H3.
What are the key properties of [1-[(1,1-difluoropropan-2-ylamino)methyl]cyclopropyl]methanol?
[1-[(1,1-difluoropropan-2-ylamino)methyl]cyclopropyl]methanol has a molecular weight of 179.21 g/mol, XLogP of 1.00, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(1,1-difluoropropan-2-ylamino)methyl]cyclopropyl]methanol is sourced from PubChem (CID 102869917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).