C18H36N2O — CID 102871050
2-[cyclobutyl-[[3-methyl-1-[(propan-2-ylamino)methyl]cyclohexyl]methyl]amino]ethanol (PubChem CID 102871050) has the molecular formula C18H36N2O and a molecular weight of 296.50 g/mol. Its IUPAC name is 2-[cyclobutyl-[[3-methyl-1-[(propan-2-ylamino)methyl]cyclohexyl]methyl]amino]ethanol.
| Compound Name | 2-[cyclobutyl-[[3-methyl-1-[(propan-2-ylamino)methyl]cyclohexyl]methyl]amino]ethanol |
|---|---|
| PubChem CID | 102871050 |
| Molecular Formula | C18H36N2O |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.28 |
| IUPAC Name | 2-[cyclobutyl-[[3-methyl-1-[(propan-2-ylamino)methyl]cyclohexyl]methyl]amino]ethanol |
| SMILES | CC1CCCC(CNC(C)C)(CN(CCO)C2CCC2)C1 |
| InChI | InChI=1S/C18H36N2O/c1-15(2)19-13-18(9-5-6-16(3)12-18)14-20(10-11-21)17-7-4-8-17/h15-17,19,21H,4-14H2,1-3H3 |
| InChIKey | ROLJXKZCEMMNNW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |