C12H15BrF3N3 — CID 102871356
N-(3-bromopropyl)-N-cyclobutyl-4-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 102871356) has the molecular formula C12H15BrF3N3 and a molecular weight of 338.17 g/mol. Its IUPAC name is N-(3-bromopropyl)-N-cyclobutyl-4-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | N-(3-bromopropyl)-N-cyclobutyl-4-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 102871356 |
| Molecular Formula | C12H15BrF3N3 |
| Molecular Weight | 338.17 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | N-(3-bromopropyl)-N-cyclobutyl-4-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | FC(F)(F)c1ccnc(N(CCCBr)C2CCC2)n1 |
| InChI | InChI=1S/C12H15BrF3N3/c13-6-2-8-19(9-3-1-4-9)11-17-7-5-10(18-11)12(14,15)16/h5,7,9H,1-4,6,8H2 |
| InChIKey | HHDGQAATKICXNE-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.17 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|