C11H16ClN3S — CID 102871748
N-(2-chloroethyl)-N-cyclobutyl-3-cyclopropyl-1,2,4-thiadiazol-5-amine (PubChem CID 102871748) has the molecular formula C11H16ClN3S and a molecular weight of 257.79 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-cyclobutyl-3-cyclopropyl-1,2,4-thiadiazol-5-amine.
| Compound Name | N-(2-chloroethyl)-N-cyclobutyl-3-cyclopropyl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 102871748 |
| Molecular Formula | C11H16ClN3S |
| Molecular Weight | 257.79 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | N-(2-chloroethyl)-N-cyclobutyl-3-cyclopropyl-1,2,4-thiadiazol-5-amine |
| SMILES | ClCCN(c1nc(C2CC2)ns1)C1CCC1 |
| InChI | InChI=1S/C11H16ClN3S/c12-6-7-15(9-2-1-3-9)11-13-10(14-16-11)8-4-5-8/h8-9H,1-7H2 |
| InChIKey | DMIMAASZDDBRPI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.79 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|