C15H19Cl2NO2 — CID 102872110
2-(3-chlorophenoxy)-N-(3-chloropropyl)-N-cyclobutylacetamide (PubChem CID 102872110) has the molecular formula C15H19Cl2NO2 and a molecular weight of 316.23 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)-N-(3-chloropropyl)-N-cyclobutylacetamide.
| Compound Name | 2-(3-chlorophenoxy)-N-(3-chloropropyl)-N-cyclobutylacetamide |
|---|---|
| PubChem CID | 102872110 |
| Molecular Formula | C15H19Cl2NO2 |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 2-(3-chlorophenoxy)-N-(3-chloropropyl)-N-cyclobutylacetamide |
| SMILES | O=C(COc1cccc(Cl)c1)N(CCCCl)C1CCC1 |
| InChI | InChI=1S/C15H19Cl2NO2/c16-8-3-9-18(13-5-2-6-13)15(19)11-20-14-7-1-4-12(17)10-14/h1,4,7,10,13H,2-3,5-6,8-9,11H2 |
| InChIKey | KNVXWTWITBNVNH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|