C13H18BrNOS — CID 102872297
N-(3-bromopropyl)-N-cyclobutyl-3-methylthiophene-2-carboxamide (PubChem CID 102872297) has the molecular formula C13H18BrNOS and a molecular weight of 316.26 g/mol. Its IUPAC name is N-(3-bromopropyl)-N-cyclobutyl-3-methylthiophene-2-carboxamide.
| Compound Name | N-(3-bromopropyl)-N-cyclobutyl-3-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 102872297 |
| Molecular Formula | C13H18BrNOS |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | N-(3-bromopropyl)-N-cyclobutyl-3-methylthiophene-2-carboxamide |
| SMILES | Cc1ccsc1C(=O)N(CCCBr)C1CCC1 |
| InChI | InChI=1S/C13H18BrNOS/c1-10-6-9-17-12(10)13(16)15(8-3-7-14)11-4-2-5-11/h6,9,11H,2-5,7-8H2,1H3 |
| InChIKey | ZIQBHOCDBCWQSA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.26 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|