C11H17BrF3NO — CID 102872495
N-(3-bromopropyl)-N-cyclobutyl-4,4,4-trifluorobutanamide (PubChem CID 102872495) has the molecular formula C11H17BrF3NO and a molecular weight of 316.16 g/mol. Its IUPAC name is N-(3-bromopropyl)-N-cyclobutyl-4,4,4-trifluorobutanamide.
| Compound Name | N-(3-bromopropyl)-N-cyclobutyl-4,4,4-trifluorobutanamide |
|---|---|
| PubChem CID | 102872495 |
| Molecular Formula | C11H17BrF3NO |
| Molecular Weight | 316.16 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | N-(3-bromopropyl)-N-cyclobutyl-4,4,4-trifluorobutanamide |
| SMILES | O=C(CCC(F)(F)F)N(CCCBr)C1CCC1 |
| InChI | InChI=1S/C11H17BrF3NO/c12-7-2-8-16(9-3-1-4-9)10(17)5-6-11(13,14)15/h9H,1-8H2 |
| InChIKey | TYASWARYGUPDFQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.16 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|