C14H17ClFNO — CID 102872699
N-(2-chloroethyl)-N-cyclobutyl-2-(2-fluorophenyl)acetamide (PubChem CID 102872699) has the molecular formula C14H17ClFNO and a molecular weight of 269.75 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-cyclobutyl-2-(2-fluorophenyl)acetamide.
| Compound Name | N-(2-chloroethyl)-N-cyclobutyl-2-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 102872699 |
| Molecular Formula | C14H17ClFNO |
| Molecular Weight | 269.75 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | N-(2-chloroethyl)-N-cyclobutyl-2-(2-fluorophenyl)acetamide |
| SMILES | O=C(Cc1ccccc1F)N(CCCl)C1CCC1 |
| InChI | InChI=1S/C14H17ClFNO/c15-8-9-17(12-5-3-6-12)14(18)10-11-4-1-2-7-13(11)16/h1-2,4,7,12H,3,5-6,8-10H2 |
| InChIKey | DBAUGBDSKPEKDS-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.75 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|