C18H19BrN4O — CID 10287337
N'-[3-bromo-7-(4-methoxyphenyl)-1,6-naphthyridin-5-yl]propane-1,3-diamine (PubChem CID 10287337) has the molecular formula C18H19BrN4O and a molecular weight of 387.28 g/mol. Its IUPAC name is N'-[3-bromo-7-(4-methoxyphenyl)-1,6-naphthyridin-5-yl]propane-1,3-diamine.
| Compound Name | N'-[3-bromo-7-(4-methoxyphenyl)-1,6-naphthyridin-5-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 10287337 |
| Molecular Formula | C18H19BrN4O |
| Molecular Weight | 387.28 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | N'-[3-bromo-7-(4-methoxyphenyl)-1,6-naphthyridin-5-yl]propane-1,3-diamine |
| SMILES | COc1ccc(-c2cc3ncc(Br)cc3c(NCCCN)n2)cc1 |
| InChI | InChI=1S/C18H19BrN4O/c1-24-14-5-3-12(4-6-14)16-10-17-15(9-13(19)11-22-17)18(23-16)21-8-2-7-20/h3-6,9-11H,2,7-8,20H2,1H3,(H,21,23) |
| InChIKey | PBBPAOSLOWQMIX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.28 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|