C14H19FN2OS — CID 102876775
1-[(2-fluoro-4-methoxyphenyl)methyl]piperidine-2-carbothioamide (PubChem CID 102876775) has the molecular formula C14H19FN2OS and a molecular weight of 282.38 g/mol. Its IUPAC name is 1-[(2-fluoro-4-methoxyphenyl)methyl]piperidine-2-carbothioamide.
| Compound Name | 1-[(2-fluoro-4-methoxyphenyl)methyl]piperidine-2-carbothioamide |
|---|---|
| PubChem CID | 102876775 |
| Molecular Formula | C14H19FN2OS |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 1-[(2-fluoro-4-methoxyphenyl)methyl]piperidine-2-carbothioamide |
| SMILES | COc1ccc(CN2CCCCC2C(N)=S)c(F)c1 |
| InChI | InChI=1S/C14H19FN2OS/c1-18-11-6-5-10(12(15)8-11)9-17-7-3-2-4-13(17)14(16)19/h5-6,8,13H,2-4,7,9H2,1H3,(H2,16,19) |
| InChIKey | KGTBAEIHCRYUKA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|