C21H20N8O2 — CID 10287801
4-(furan-2-yl)-10-[2-(5-methoxy-1,3-dihydroisoindol-2-yl)ethyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine (PubChem CID 10287801) has the molecular formula C21H20N8O2 and a molecular weight of 416.45 g/mol. Its IUPAC name is 4-(furan-2-yl)-10-[2-(5-methoxy-1,3-dihydroisoindol-2-yl)ethyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine.
| Compound Name | 4-(furan-2-yl)-10-[2-(5-methoxy-1,3-dihydroisoindol-2-yl)ethyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine |
|---|---|
| PubChem CID | 10287801 |
| Molecular Formula | C21H20N8O2 |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 4-(furan-2-yl)-10-[2-(5-methoxy-1,3-dihydroisoindol-2-yl)ethyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine |
| SMILES | COc1ccc2c(c1)CN(CCn1ncc3c1nc(N)n1nc(-c4ccco4)nc31)C2 |
| InChI | InChI=1S/C21H20N8O2/c1-30-15-5-4-13-11-27(12-14(13)9-15)6-7-28-19-16(10-23-28)20-24-18(17-3-2-8-31-17)26-29(20)21(22)25-19/h2-5,8-10H,6-7,11-12H2,1H3,(H2,22,25) |
| InChIKey | CMGVRLPXTCGYEI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 112.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |