C17H23FO3 — CID 102879847
4-ethyl-1-[(2-fluoro-4-methoxyphenyl)methyl]cyclohexane-1-carboxylic acid (PubChem CID 102879847) has the molecular formula C17H23FO3 and a molecular weight of 294.37 g/mol. Its IUPAC name is 4-ethyl-1-[(2-fluoro-4-methoxyphenyl)methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-ethyl-1-[(2-fluoro-4-methoxyphenyl)methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 102879847 |
| Molecular Formula | C17H23FO3 |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 4-ethyl-1-[(2-fluoro-4-methoxyphenyl)methyl]cyclohexane-1-carboxylic acid |
| SMILES | CCC1CCC(Cc2ccc(OC)cc2F)(C(=O)O)CC1 |
| InChI | InChI=1S/C17H23FO3/c1-3-12-6-8-17(9-7-12,16(19)20)11-13-4-5-14(21-2)10-15(13)18/h4-5,10,12H,3,6-9,11H2,1-2H3,(H,19,20) |
| InChIKey | JXTWICMYNQPVHW-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |