About 3-methylanthracene-1,8,9-triol
3-methylanthracene-1,8,9-triol (PubChem CID 10288) has the molecular formula C15H12O3
and a molecular weight of 240.26 g/mol. Its IUPAC name is 3-methylanthracene-1,8,9-triol.
Molecular Properties
| Compound Name | 3-methylanthracene-1,8,9-triol |
| PubChem CID | 10288 |
| Molecular Formula | C15H12O3 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 3-methylanthracene-1,8,9-triol |
| SMILES | Cc1cc(O)c2c(O)c3c(O)cccc3cc2c1 |
| InChI | InChI=1S/C15H12O3/c1-8-5-10-7-9-3-2-4-11(16)13(9)15(18)14(10)12(17)6-8/h2-7,16-18H,1H3 |
| InChIKey | JBGKVNQFVAJOGC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 3-methylanthracene-1,8,9-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylanthracene-1,8,9-triol?
The IUPAC name of 3-methylanthracene-1,8,9-triol (CID 10288) is 3-methylanthracene-1,8,9-triol.
What is the SMILES notation for 3-methylanthracene-1,8,9-triol?
The canonical SMILES for 3-methylanthracene-1,8,9-triol is Cc1cc(O)c2c(O)c3c(O)cccc3cc2c1.
What is the InChIKey of 3-methylanthracene-1,8,9-triol?
The InChIKey is JBGKVNQFVAJOGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12O3/c1-8-5-10-7-9-3-2-4-11(16)13(9)15(18)14(10)12(17)6-8/h2-7,16-18H,1H3.
What are the key properties of 3-methylanthracene-1,8,9-triol?
3-methylanthracene-1,8,9-triol has a molecular weight of 240.26 g/mol, XLogP of 3.42, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylanthracene-1,8,9-triol is sourced from PubChem (CID 10288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).