About N'-cyclopropyl-N'-[(5-methyl-3-pyridinyl)methyl]propane-1,3-diamine
N'-cyclopropyl-N'-[(5-methyl-3-pyridinyl)methyl]propane-1,3-diamine (PubChem CID 102880556) has the molecular formula C13H21N3
and a molecular weight of 219.33 g/mol. Its IUPAC name is N'-cyclopropyl-N'-[(5-methyl-3-pyridinyl)methyl]propane-1,3-diamine.
Molecular Properties
| Compound Name | N'-cyclopropyl-N'-[(5-methyl-3-pyridinyl)methyl]propane-1,3-diamine |
| PubChem CID | 102880556 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | N'-cyclopropyl-N'-[(5-methyl-3-pyridinyl)methyl]propane-1,3-diamine |
| SMILES | Cc1cncc(CN(CCCN)C2CC2)c1 |
| InChI | InChI=1S/C13H21N3/c1-11-7-12(9-15-8-11)10-16(6-2-5-14)13-3-4-13/h7-9,13H,2-6,10,14H2,1H3 |
| InChIKey | OOWDUKAPBHDYJL-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N'-cyclopropyl-N'-[(5-methyl-3-pyridinyl)methyl]propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-cyclopropyl-N'-[(5-methyl-3-pyridinyl)methyl]propane-1,3-diamine?
The IUPAC name of N'-cyclopropyl-N'-[(5-methyl-3-pyridinyl)methyl]propane-1,3-diamine (CID 102880556) is N'-cyclopropyl-N'-[(5-methyl-3-pyridinyl)methyl]propane-1,3-diamine.
What is the SMILES notation for N'-cyclopropyl-N'-[(5-methyl-3-pyridinyl)methyl]propane-1,3-diamine?
The canonical SMILES for N'-cyclopropyl-N'-[(5-methyl-3-pyridinyl)methyl]propane-1,3-diamine is Cc1cncc(CN(CCCN)C2CC2)c1.
What is the InChIKey of N'-cyclopropyl-N'-[(5-methyl-3-pyridinyl)methyl]propane-1,3-diamine?
The InChIKey is OOWDUKAPBHDYJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3/c1-11-7-12(9-15-8-11)10-16(6-2-5-14)13-3-4-13/h7-9,13H,2-6,10,14H2,1H3.
What are the key properties of N'-cyclopropyl-N'-[(5-methyl-3-pyridinyl)methyl]propane-1,3-diamine?
N'-cyclopropyl-N'-[(5-methyl-3-pyridinyl)methyl]propane-1,3-diamine has a molecular weight of 219.33 g/mol, XLogP of 1.70, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-cyclopropyl-N'-[(5-methyl-3-pyridinyl)methyl]propane-1,3-diamine is sourced from PubChem (CID 102880556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).