C18H25F3N4O3S — CID 10288073
3-[2-[2-adamantyl(amino)amino]acetyl]-1,3-thiazolidine-4-carbonitrile;2,2,2-trifluoroacetic acid (PubChem CID 10288073) has the molecular formula C18H25F3N4O3S and a molecular weight of 434.48 g/mol. Its IUPAC name is 3-[2-[2-adamantyl(amino)amino]acetyl]-1,3-thiazolidine-4-carbonitrile;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[2-[2-adamantyl(amino)amino]acetyl]-1,3-thiazolidine-4-carbonitrile;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 10288073 |
| Molecular Formula | C18H25F3N4O3S |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 3-[2-[2-adamantyl(amino)amino]acetyl]-1,3-thiazolidine-4-carbonitrile;2,2,2-trifluoroacetic acid |
| SMILES | N#CC1CSCN1C(=O)CN(N)C1C2CC3CC(C2)CC1C3.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H24N4OS.C2HF3O2/c17-6-14-8-22-9-19(14)15(21)7-20(18)16-12-2-10-1-11(4-12)5-13(16)3-10;3-2(4,5)1(6)7/h10-14,16H,1-5,7-9,18H2;(H,6,7) |
| InChIKey | LZNNPDKHPUMVCA-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 110.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|