C26H31NO5 — CID 10288125
ethyl (E)-4-(4-tert-butylphenyl)-6-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-6-oxohex-4-enoate (PubChem CID 10288125) has the molecular formula C26H31NO5 and a molecular weight of 437.54 g/mol. Its IUPAC name is ethyl (E)-4-(4-tert-butylphenyl)-6-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-6-oxohex-4-enoate.
| Compound Name | ethyl (E)-4-(4-tert-butylphenyl)-6-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-6-oxohex-4-enoate |
|---|---|
| PubChem CID | 10288125 |
| Molecular Formula | C26H31NO5 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | ethyl (E)-4-(4-tert-butylphenyl)-6-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-6-oxohex-4-enoate |
| SMILES | CCOC(=O)CC/C(=C\C(=O)Nc1ccc2c(c1)OCCO2)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C26H31NO5/c1-5-30-25(29)13-8-19(18-6-9-20(10-7-18)26(2,3)4)16-24(28)27-21-11-12-22-23(17-21)32-15-14-31-22/h6-7,9-12,16-17H,5,8,13-15H2,1-4H3,(H,27,28)/b19-16+ |
| InChIKey | BQVRRSBEEJDHHY-KNTRCKAVSA-N |
| XLogP | 5.12 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|