C14H12FNO4S — CID 102881270
4-fluoro-3-[(5-methyl-3-pyridinyl)methylsulfonyl]benzoic acid (PubChem CID 102881270) has the molecular formula C14H12FNO4S and a molecular weight of 309.32 g/mol. Its IUPAC name is 4-fluoro-3-[(5-methyl-3-pyridinyl)methylsulfonyl]benzoic acid.
| Compound Name | 4-fluoro-3-[(5-methyl-3-pyridinyl)methylsulfonyl]benzoic acid |
|---|---|
| PubChem CID | 102881270 |
| Molecular Formula | C14H12FNO4S |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 4-fluoro-3-[(5-methyl-3-pyridinyl)methylsulfonyl]benzoic acid |
| SMILES | Cc1cncc(CS(=O)(=O)c2cc(C(=O)O)ccc2F)c1 |
| InChI | InChI=1S/C14H12FNO4S/c1-9-4-10(7-16-6-9)8-21(19,20)13-5-11(14(17)18)2-3-12(13)15/h2-7H,8H2,1H3,(H,17,18) |
| InChIKey | ZLEDIGPMKUMHJP-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |