About 1-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)-1-(2-methylphenyl)propan-2-amine
1-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)-1-(2-methylphenyl)propan-2-amine (PubChem CID 102882810) has the molecular formula C15H24N2O2S
and a molecular weight of 296.44 g/mol. Its IUPAC name is 1-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)-1-(2-methylphenyl)propan-2-amine.
Molecular Properties
| Compound Name | 1-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)-1-(2-methylphenyl)propan-2-amine |
| PubChem CID | 102882810 |
| Molecular Formula | C15H24N2O2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 1-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)-1-(2-methylphenyl)propan-2-amine |
| SMILES | Cc1ccccc1C(C(C)N)N1CCS(=O)(=O)CC1C |
| InChI | InChI=1S/C15H24N2O2S/c1-11-6-4-5-7-14(11)15(13(3)16)17-8-9-20(18,19)10-12(17)2/h4-7,12-13,15H,8-10,16H2,1-3H3 |
| InChIKey | MRSSPJYCBCRLKJ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)-1-(2-methylphenyl)propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)-1-(2-methylphenyl)propan-2-amine?
The IUPAC name of 1-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)-1-(2-methylphenyl)propan-2-amine (CID 102882810) is 1-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)-1-(2-methylphenyl)propan-2-amine.
What is the SMILES notation for 1-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)-1-(2-methylphenyl)propan-2-amine?
The canonical SMILES for 1-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)-1-(2-methylphenyl)propan-2-amine is Cc1ccccc1C(C(C)N)N1CCS(=O)(=O)CC1C.
What is the InChIKey of 1-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)-1-(2-methylphenyl)propan-2-amine?
The InChIKey is MRSSPJYCBCRLKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O2S/c1-11-6-4-5-7-14(11)15(13(3)16)17-8-9-20(18,19)10-12(17)2/h4-7,12-13,15H,8-10,16H2,1-3H3.
What are the key properties of 1-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)-1-(2-methylphenyl)propan-2-amine?
1-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)-1-(2-methylphenyl)propan-2-amine has a molecular weight of 296.44 g/mol, XLogP of 1.50, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)-1-(2-methylphenyl)propan-2-amine is sourced from PubChem (CID 102882810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).