About 3-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)pyridazine-4-carboximidamide
3-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)pyridazine-4-carboximidamide (PubChem CID 102883786) has the molecular formula C10H15N5O2S
and a molecular weight of 269.33 g/mol. Its IUPAC name is 3-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)pyridazine-4-carboximidamide.
Molecular Properties
| Compound Name | 3-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)pyridazine-4-carboximidamide |
| PubChem CID | 102883786 |
| Molecular Formula | C10H15N5O2S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 3-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)pyridazine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccnnc1N1CCS(=O)(=O)CC1C |
| InChI | InChI=1S/C10H15N5O2S/c1-7-6-18(16,17)5-4-15(7)10-8(9(11)12)2-3-13-14-10/h2-3,7H,4-6H2,1H3,(H3,11,12) |
| InChIKey | WRTVOGUTMJWNQT-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 113.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)pyridazine-4-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)pyridazine-4-carboximidamide?
The IUPAC name of 3-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)pyridazine-4-carboximidamide (CID 102883786) is 3-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)pyridazine-4-carboximidamide.
What is the SMILES notation for 3-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)pyridazine-4-carboximidamide?
The canonical SMILES for 3-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)pyridazine-4-carboximidamide is [H]/N=C(\N)c1ccnnc1N1CCS(=O)(=O)CC1C.
What is the InChIKey of 3-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)pyridazine-4-carboximidamide?
The InChIKey is WRTVOGUTMJWNQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N5O2S/c1-7-6-18(16,17)5-4-15(7)10-8(9(11)12)2-3-13-14-10/h2-3,7H,4-6H2,1H3,(H3,11,12).
What are the key properties of 3-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)pyridazine-4-carboximidamide?
3-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)pyridazine-4-carboximidamide has a molecular weight of 269.33 g/mol, XLogP of -0.62, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)pyridazine-4-carboximidamide is sourced from PubChem (CID 102883786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).