About 3-fluoro-2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)benzoic acid
3-fluoro-2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)benzoic acid (PubChem CID 102883850) has the molecular formula C12H14FNO4S
and a molecular weight of 287.31 g/mol. Its IUPAC name is 3-fluoro-2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)benzoic acid.
Molecular Properties
| Compound Name | 3-fluoro-2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)benzoic acid |
| PubChem CID | 102883850 |
| Molecular Formula | C12H14FNO4S |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 3-fluoro-2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)benzoic acid |
| SMILES | CC1CS(=O)(=O)CCN1c1c(F)cccc1C(=O)O |
| InChI | InChI=1S/C12H14FNO4S/c1-8-7-19(17,18)6-5-14(8)11-9(12(15)16)3-2-4-10(11)13/h2-4,8H,5-7H2,1H3,(H,15,16) |
| InChIKey | GYHNCULZCQCEPM-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-fluoro-2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)benzoic acid?
The IUPAC name of 3-fluoro-2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)benzoic acid (CID 102883850) is 3-fluoro-2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)benzoic acid.
What is the SMILES notation for 3-fluoro-2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)benzoic acid?
The canonical SMILES for 3-fluoro-2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)benzoic acid is CC1CS(=O)(=O)CCN1c1c(F)cccc1C(=O)O.
What is the InChIKey of 3-fluoro-2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)benzoic acid?
The InChIKey is GYHNCULZCQCEPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14FNO4S/c1-8-7-19(17,18)6-5-14(8)11-9(12(15)16)3-2-4-10(11)13/h2-4,8H,5-7H2,1H3,(H,15,16).
What are the key properties of 3-fluoro-2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)benzoic acid?
3-fluoro-2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)benzoic acid has a molecular weight of 287.31 g/mol, XLogP of 1.15, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)benzoic acid is sourced from PubChem (CID 102883850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).