C26H22F3NO3 — CID 10288389
3-amino-5-[2-[2-phenylmethoxy-5-(trifluoromethyl)phenyl]cyclopenten-1-yl]benzoic acid (PubChem CID 10288389) has the molecular formula C26H22F3NO3 and a molecular weight of 453.46 g/mol. Its IUPAC name is 3-amino-5-[2-[2-phenylmethoxy-5-(trifluoromethyl)phenyl]cyclopenten-1-yl]benzoic acid.
| Compound Name | 3-amino-5-[2-[2-phenylmethoxy-5-(trifluoromethyl)phenyl]cyclopenten-1-yl]benzoic acid |
|---|---|
| PubChem CID | 10288389 |
| Molecular Formula | C26H22F3NO3 |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | 3-amino-5-[2-[2-phenylmethoxy-5-(trifluoromethyl)phenyl]cyclopenten-1-yl]benzoic acid |
| SMILES | Nc1cc(C(=O)O)cc(C2=C(c3cc(C(F)(F)F)ccc3OCc3ccccc3)CCC2)c1 |
| InChI | InChI=1S/C26H22F3NO3/c27-26(28,29)19-9-10-24(33-15-16-5-2-1-3-6-16)23(14-19)22-8-4-7-21(22)17-11-18(25(31)32)13-20(30)12-17/h1-3,5-6,9-14H,4,7-8,15,30H2,(H,31,32) |
| InChIKey | JLWJKKKRIRCWAW-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|