C12H17ClN2O2S — CID 102884244
3-chloro-5-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]aniline (PubChem CID 102884244) has the molecular formula C12H17ClN2O2S and a molecular weight of 288.80 g/mol. Its IUPAC name is 3-chloro-5-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]aniline.
| Compound Name | 3-chloro-5-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]aniline |
|---|---|
| PubChem CID | 102884244 |
| Molecular Formula | C12H17ClN2O2S |
| Molecular Weight | 288.80 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 3-chloro-5-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]aniline |
| SMILES | CC1CS(=O)(=O)CCN1Cc1cc(N)cc(Cl)c1 |
| InChI | InChI=1S/C12H17ClN2O2S/c1-9-8-18(16,17)3-2-15(9)7-10-4-11(13)6-12(14)5-10/h4-6,9H,2-3,7-8,14H2,1H3 |
| InChIKey | FVHCSULJJGNWPN-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.80 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|