About 4-bromo-2-(2,6-dichlorophenyl)-5-[(3,4-difluorophenyl)methoxy]pyridazin-3-one
4-bromo-2-(2,6-dichlorophenyl)-5-[(3,4-difluorophenyl)methoxy]pyridazin-3-one (PubChem CID 10288541) has the molecular formula C17H9BrCl2F2N2O2
and a molecular weight of 462.08 g/mol. Its IUPAC name is 4-bromo-2-(2,6-dichlorophenyl)-5-[(3,4-difluorophenyl)methoxy]pyridazin-3-one.
Molecular Properties
| Compound Name | 4-bromo-2-(2,6-dichlorophenyl)-5-[(3,4-difluorophenyl)methoxy]pyridazin-3-one |
| PubChem CID | 10288541 |
| Molecular Formula | C17H9BrCl2F2N2O2 |
| Molecular Weight | 462.08 g/mol |
| Exact Mass | 459.92 |
| IUPAC Name | 4-bromo-2-(2,6-dichlorophenyl)-5-[(3,4-difluorophenyl)methoxy]pyridazin-3-one |
| SMILES | O=c1c(Br)c(OCc2ccc(F)c(F)c2)cnn1-c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C17H9BrCl2F2N2O2/c18-15-14(26-8-9-4-5-12(21)13(22)6-9)7-23-24(17(15)25)16-10(19)2-1-3-11(16)20/h1-7H,8H2 |
| InChIKey | BCUBBWKUZKBCOJ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 462.08 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-bromo-2-(2,6-dichlorophenyl)-5-[(3,4-difluorophenyl)methoxy]pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2-(2,6-dichlorophenyl)-5-[(3,4-difluorophenyl)methoxy]pyridazin-3-one?
The IUPAC name of 4-bromo-2-(2,6-dichlorophenyl)-5-[(3,4-difluorophenyl)methoxy]pyridazin-3-one (CID 10288541) is 4-bromo-2-(2,6-dichlorophenyl)-5-[(3,4-difluorophenyl)methoxy]pyridazin-3-one.
What is the SMILES notation for 4-bromo-2-(2,6-dichlorophenyl)-5-[(3,4-difluorophenyl)methoxy]pyridazin-3-one?
The canonical SMILES for 4-bromo-2-(2,6-dichlorophenyl)-5-[(3,4-difluorophenyl)methoxy]pyridazin-3-one is O=c1c(Br)c(OCc2ccc(F)c(F)c2)cnn1-c1c(Cl)cccc1Cl.
What is the InChIKey of 4-bromo-2-(2,6-dichlorophenyl)-5-[(3,4-difluorophenyl)methoxy]pyridazin-3-one?
The InChIKey is BCUBBWKUZKBCOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H9BrCl2F2N2O2/c18-15-14(26-8-9-4-5-12(21)13(22)6-9)7-23-24(17(15)25)16-10(19)2-1-3-11(16)20/h1-7H,8H2.
What are the key properties of 4-bromo-2-(2,6-dichlorophenyl)-5-[(3,4-difluorophenyl)methoxy]pyridazin-3-one?
4-bromo-2-(2,6-dichlorophenyl)-5-[(3,4-difluorophenyl)methoxy]pyridazin-3-one has a molecular weight of 462.08 g/mol, XLogP of 5.16, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-(2,6-dichlorophenyl)-5-[(3,4-difluorophenyl)methoxy]pyridazin-3-one is sourced from PubChem (CID 10288541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).