C12H13FN4O3 — CID 102885707
2-[5-(2-fluoro-4-methoxyphenyl)tetrazol-1-yl]-2-methylpropanoic acid (PubChem CID 102885707) has the molecular formula C12H13FN4O3 and a molecular weight of 280.26 g/mol. Its IUPAC name is 2-[5-(2-fluoro-4-methoxyphenyl)tetrazol-1-yl]-2-methylpropanoic acid.
| Compound Name | 2-[5-(2-fluoro-4-methoxyphenyl)tetrazol-1-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 102885707 |
| Molecular Formula | C12H13FN4O3 |
| Molecular Weight | 280.26 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 2-[5-(2-fluoro-4-methoxyphenyl)tetrazol-1-yl]-2-methylpropanoic acid |
| SMILES | COc1ccc(-c2nnnn2C(C)(C)C(=O)O)c(F)c1 |
| InChI | InChI=1S/C12H13FN4O3/c1-12(2,11(18)19)17-10(14-15-16-17)8-5-4-7(20-3)6-9(8)13/h4-6H,1-3H3,(H,18,19) |
| InChIKey | MZMLYPYBODIDGM-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.26 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |