C12H13BrFN3O — CID 102885880
3-(bromomethyl)-4-ethyl-5-(2-fluoro-4-methoxyphenyl)-1,2,4-triazole (PubChem CID 102885880) has the molecular formula C12H13BrFN3O and a molecular weight of 314.16 g/mol. Its IUPAC name is 3-(bromomethyl)-4-ethyl-5-(2-fluoro-4-methoxyphenyl)-1,2,4-triazole.
| Compound Name | 3-(bromomethyl)-4-ethyl-5-(2-fluoro-4-methoxyphenyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 102885880 |
| Molecular Formula | C12H13BrFN3O |
| Molecular Weight | 314.16 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | 3-(bromomethyl)-4-ethyl-5-(2-fluoro-4-methoxyphenyl)-1,2,4-triazole |
| SMILES | CCn1c(CBr)nnc1-c1ccc(OC)cc1F |
| InChI | InChI=1S/C12H13BrFN3O/c1-3-17-11(7-13)15-16-12(17)9-5-4-8(18-2)6-10(9)14/h4-6H,3,7H2,1-2H3 |
| InChIKey | OLWZDLLOGQHTBT-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.16 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|