C8H13BrF3NO2S — CID 102885919
4-(2-bromo-3,3,3-trifluoropropyl)-3-methyl-1,4-thiazinane 1,1-dioxide (PubChem CID 102885919) has the molecular formula C8H13BrF3NO2S and a molecular weight of 324.16 g/mol. Its IUPAC name is 4-(2-bromo-3,3,3-trifluoropropyl)-3-methyl-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-(2-bromo-3,3,3-trifluoropropyl)-3-methyl-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 102885919 |
| Molecular Formula | C8H13BrF3NO2S |
| Molecular Weight | 324.16 g/mol |
| Exact Mass | 322.98 |
| IUPAC Name | 4-(2-bromo-3,3,3-trifluoropropyl)-3-methyl-1,4-thiazinane 1,1-dioxide |
| SMILES | CC1CS(=O)(=O)CCN1CC(Br)C(F)(F)F |
| InChI | InChI=1S/C8H13BrF3NO2S/c1-6-5-16(14,15)3-2-13(6)4-7(9)8(10,11)12/h6-7H,2-5H2,1H3 |
| InChIKey | UZPYNIRFFYBLQX-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.16 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|