About 4-tert-butyl-2-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]cyclohexan-1-amine
4-tert-butyl-2-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]cyclohexan-1-amine (PubChem CID 102886488) has the molecular formula C16H32N2O2S
and a molecular weight of 316.51 g/mol. Its IUPAC name is 4-tert-butyl-2-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]cyclohexan-1-amine.
Molecular Properties
| Compound Name | 4-tert-butyl-2-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]cyclohexan-1-amine |
| PubChem CID | 102886488 |
| Molecular Formula | C16H32N2O2S |
| Molecular Weight | 316.51 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | 4-tert-butyl-2-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]cyclohexan-1-amine |
| SMILES | CC1CS(=O)(=O)CCN1CC1CC(C(C)(C)C)CCC1N |
| InChI | InChI=1S/C16H32N2O2S/c1-12-11-21(19,20)8-7-18(12)10-13-9-14(16(2,3)4)5-6-15(13)17/h12-15H,5-11,17H2,1-4H3 |
| InChIKey | LXNCCFRRWLGTCL-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.51 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-tert-butyl-2-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-2-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]cyclohexan-1-amine?
The IUPAC name of 4-tert-butyl-2-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]cyclohexan-1-amine (CID 102886488) is 4-tert-butyl-2-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]cyclohexan-1-amine.
What is the SMILES notation for 4-tert-butyl-2-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]cyclohexan-1-amine?
The canonical SMILES for 4-tert-butyl-2-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]cyclohexan-1-amine is CC1CS(=O)(=O)CCN1CC1CC(C(C)(C)C)CCC1N.
What is the InChIKey of 4-tert-butyl-2-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]cyclohexan-1-amine?
The InChIKey is LXNCCFRRWLGTCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32N2O2S/c1-12-11-21(19,20)8-7-18(12)10-13-9-14(16(2,3)4)5-6-15(13)17/h12-15H,5-11,17H2,1-4H3.
What are the key properties of 4-tert-butyl-2-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]cyclohexan-1-amine?
4-tert-butyl-2-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]cyclohexan-1-amine has a molecular weight of 316.51 g/mol, XLogP of 1.89, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-2-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]cyclohexan-1-amine is sourced from PubChem (CID 102886488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).