C15H30N2O3S — CID 102886586
N,2,2,5,5-pentamethyl-4-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]oxolan-3-amine (PubChem CID 102886586) has the molecular formula C15H30N2O3S and a molecular weight of 318.48 g/mol. Its IUPAC name is N,2,2,5,5-pentamethyl-4-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]oxolan-3-amine.
| Compound Name | N,2,2,5,5-pentamethyl-4-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]oxolan-3-amine |
|---|---|
| PubChem CID | 102886586 |
| Molecular Formula | C15H30N2O3S |
| Molecular Weight | 318.48 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | N,2,2,5,5-pentamethyl-4-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]oxolan-3-amine |
| SMILES | CNC1C(CN2CCS(=O)(=O)CC2C)C(C)(C)OC1(C)C |
| InChI | InChI=1S/C15H30N2O3S/c1-11-10-21(18,19)8-7-17(11)9-12-13(16-6)15(4,5)20-14(12,2)3/h11-13,16H,7-10H2,1-6H3 |
| InChIKey | NJYZLZHRMLGCFF-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.48 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |