About trifluoro-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]boranuide
trifluoro-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]boranuide (PubChem CID 102887224) has the molecular formula C6H12BF3NO2S-
and a molecular weight of 230.04 g/mol. Its IUPAC name is trifluoro-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]boranuide.
Molecular Properties
| Compound Name | trifluoro-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]boranuide |
| PubChem CID | 102887224 |
| Molecular Formula | C6H12BF3NO2S- |
| Molecular Weight | 230.04 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | trifluoro-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]boranuide |
| SMILES | CC1CS(=O)(=O)CCN1C[B-](F)(F)F |
| InChI | InChI=1S/C6H12BF3NO2S/c1-6-4-14(12,13)3-2-11(6)5-7(8,9)10/h6H,2-5H2,1H3/q-1 |
| InChIKey | QZDACCPVYIIAME-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.04 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trifluoro-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]boranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trifluoro-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]boranuide?
The IUPAC name of trifluoro-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]boranuide (CID 102887224) is trifluoro-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]boranuide.
What is the SMILES notation for trifluoro-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]boranuide?
The canonical SMILES for trifluoro-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]boranuide is CC1CS(=O)(=O)CCN1C[B-](F)(F)F.
What is the InChIKey of trifluoro-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]boranuide?
The InChIKey is QZDACCPVYIIAME-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12BF3NO2S/c1-6-4-14(12,13)3-2-11(6)5-7(8,9)10/h6H,2-5H2,1H3/q-1.
What are the key properties of trifluoro-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]boranuide?
trifluoro-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]boranuide has a molecular weight of 230.04 g/mol, XLogP of 0.49, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trifluoro-[(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methyl]boranuide is sourced from PubChem (CID 102887224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).