About 1-amino-2-methyl-4-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)butan-2-ol
1-amino-2-methyl-4-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)butan-2-ol (PubChem CID 102887351) has the molecular formula C10H22N2O3S
and a molecular weight of 250.36 g/mol. Its IUPAC name is 1-amino-2-methyl-4-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)butan-2-ol.
Molecular Properties
| Compound Name | 1-amino-2-methyl-4-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)butan-2-ol |
| PubChem CID | 102887351 |
| Molecular Formula | C10H22N2O3S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 1-amino-2-methyl-4-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)butan-2-ol |
| SMILES | CC1CS(=O)(=O)CCN1CCC(C)(O)CN |
| InChI | InChI=1S/C10H22N2O3S/c1-9-7-16(14,15)6-5-12(9)4-3-10(2,13)8-11/h9,13H,3-8,11H2,1-2H3 |
| InChIKey | BYCKEEMZIXXDBW-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-amino-2-methyl-4-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-2-methyl-4-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)butan-2-ol?
The IUPAC name of 1-amino-2-methyl-4-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)butan-2-ol (CID 102887351) is 1-amino-2-methyl-4-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)butan-2-ol.
What is the SMILES notation for 1-amino-2-methyl-4-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)butan-2-ol?
The canonical SMILES for 1-amino-2-methyl-4-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)butan-2-ol is CC1CS(=O)(=O)CCN1CCC(C)(O)CN.
What is the InChIKey of 1-amino-2-methyl-4-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)butan-2-ol?
The InChIKey is BYCKEEMZIXXDBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2O3S/c1-9-7-16(14,15)6-5-12(9)4-3-10(2,13)8-11/h9,13H,3-8,11H2,1-2H3.
What are the key properties of 1-amino-2-methyl-4-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)butan-2-ol?
1-amino-2-methyl-4-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)butan-2-ol has a molecular weight of 250.36 g/mol, XLogP of -0.79, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-2-methyl-4-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)butan-2-ol is sourced from PubChem (CID 102887351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).