C9H19ClN2O4S2 — CID 102887444
N-(3-chloropropyl)-N,3-dimethyl-1,1-dioxo-1,4-thiazinane-4-sulfonamide (PubChem CID 102887444) has the molecular formula C9H19ClN2O4S2 and a molecular weight of 318.85 g/mol. Its IUPAC name is N-(3-chloropropyl)-N,3-dimethyl-1,1-dioxo-1,4-thiazinane-4-sulfonamide.
| Compound Name | N-(3-chloropropyl)-N,3-dimethyl-1,1-dioxo-1,4-thiazinane-4-sulfonamide |
|---|---|
| PubChem CID | 102887444 |
| Molecular Formula | C9H19ClN2O4S2 |
| Molecular Weight | 318.85 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | N-(3-chloropropyl)-N,3-dimethyl-1,1-dioxo-1,4-thiazinane-4-sulfonamide |
| SMILES | CC1CS(=O)(=O)CCN1S(=O)(=O)N(C)CCCCl |
| InChI | InChI=1S/C9H19ClN2O4S2/c1-9-8-17(13,14)7-6-12(9)18(15,16)11(2)5-3-4-10/h9H,3-8H2,1-2H3 |
| InChIKey | IOVYORALTJQKRS-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.85 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|