C25H26FN7O2 — CID 10288755
5-[2-(2-amino-N-methylanilino)pyrimidin-4-yl]-4-(4-fluorophenyl)-2-methyl-1-morpholin-4-ylpyrazol-3-one (PubChem CID 10288755) has the molecular formula C25H26FN7O2 and a molecular weight of 475.53 g/mol. Its IUPAC name is 5-[2-(2-amino-N-methylanilino)pyrimidin-4-yl]-4-(4-fluorophenyl)-2-methyl-1-morpholin-4-ylpyrazol-3-one.
| Compound Name | 5-[2-(2-amino-N-methylanilino)pyrimidin-4-yl]-4-(4-fluorophenyl)-2-methyl-1-morpholin-4-ylpyrazol-3-one |
|---|---|
| PubChem CID | 10288755 |
| Molecular Formula | C25H26FN7O2 |
| Molecular Weight | 475.53 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | 5-[2-(2-amino-N-methylanilino)pyrimidin-4-yl]-4-(4-fluorophenyl)-2-methyl-1-morpholin-4-ylpyrazol-3-one |
| SMILES | CN(c1nccc(-c2c(-c3ccc(F)cc3)c(=O)n(C)n2N2CCOCC2)n1)c1ccccc1N |
| InChI | InChI=1S/C25H26FN7O2/c1-30(21-6-4-3-5-19(21)27)25-28-12-11-20(29-25)23-22(17-7-9-18(26)10-8-17)24(34)31(2)33(23)32-13-15-35-16-14-32/h3-12H,13-16,27H2,1-2H3 |
| InChIKey | AUPZZOCAFPXGNJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 94.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.53 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|