C11H15F3N4O2S — CID 102887939
[6-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)-4-(trifluoromethyl)-2-pyridinyl]hydrazine (PubChem CID 102887939) has the molecular formula C11H15F3N4O2S and a molecular weight of 324.33 g/mol. Its IUPAC name is [6-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)-4-(trifluoromethyl)-2-pyridinyl]hydrazine.
| Compound Name | [6-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)-4-(trifluoromethyl)-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 102887939 |
| Molecular Formula | C11H15F3N4O2S |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | [6-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)-4-(trifluoromethyl)-2-pyridinyl]hydrazine |
| SMILES | CC1CS(=O)(=O)CCN1c1cc(C(F)(F)F)cc(NN)n1 |
| InChI | InChI=1S/C11H15F3N4O2S/c1-7-6-21(19,20)3-2-18(7)10-5-8(11(12,13)14)4-9(16-10)17-15/h4-5,7H,2-3,6,15H2,1H3,(H,16,17) |
| InChIKey | JCBPKFCOFMIRBD-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|