About N-amino-3-methyl-1,1-dioxo-N'-propyl-1,4-thiazinane-4-carboximidamide
N-amino-3-methyl-1,1-dioxo-N'-propyl-1,4-thiazinane-4-carboximidamide (PubChem CID 102888020) has the molecular formula C9H20N4O2S
and a molecular weight of 248.35 g/mol. Its IUPAC name is N-amino-3-methyl-1,1-dioxo-N'-propyl-1,4-thiazinane-4-carboximidamide.
Molecular Properties
| Compound Name | N-amino-3-methyl-1,1-dioxo-N'-propyl-1,4-thiazinane-4-carboximidamide |
| PubChem CID | 102888020 |
| Molecular Formula | C9H20N4O2S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | N-amino-3-methyl-1,1-dioxo-N'-propyl-1,4-thiazinane-4-carboximidamide |
| SMILES | CCC/N=C(\NN)N1CCS(=O)(=O)CC1C |
| InChI | InChI=1S/C9H20N4O2S/c1-3-4-11-9(12-10)13-5-6-16(14,15)7-8(13)2/h8H,3-7,10H2,1-2H3,(H,11,12) |
| InChIKey | GPPVLEJLNJHKIO-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-amino-3-methyl-1,1-dioxo-N'-propyl-1,4-thiazinane-4-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-amino-3-methyl-1,1-dioxo-N'-propyl-1,4-thiazinane-4-carboximidamide?
The IUPAC name of N-amino-3-methyl-1,1-dioxo-N'-propyl-1,4-thiazinane-4-carboximidamide (CID 102888020) is N-amino-3-methyl-1,1-dioxo-N'-propyl-1,4-thiazinane-4-carboximidamide.
What is the SMILES notation for N-amino-3-methyl-1,1-dioxo-N'-propyl-1,4-thiazinane-4-carboximidamide?
The canonical SMILES for N-amino-3-methyl-1,1-dioxo-N'-propyl-1,4-thiazinane-4-carboximidamide is CCC/N=C(\NN)N1CCS(=O)(=O)CC1C.
What is the InChIKey of N-amino-3-methyl-1,1-dioxo-N'-propyl-1,4-thiazinane-4-carboximidamide?
The InChIKey is GPPVLEJLNJHKIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N4O2S/c1-3-4-11-9(12-10)13-5-6-16(14,15)7-8(13)2/h8H,3-7,10H2,1-2H3,(H,11,12).
What are the key properties of N-amino-3-methyl-1,1-dioxo-N'-propyl-1,4-thiazinane-4-carboximidamide?
N-amino-3-methyl-1,1-dioxo-N'-propyl-1,4-thiazinane-4-carboximidamide has a molecular weight of 248.35 g/mol, XLogP of -0.67, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-amino-3-methyl-1,1-dioxo-N'-propyl-1,4-thiazinane-4-carboximidamide is sourced from PubChem (CID 102888020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).