C9H13N3O3S — CID 102888056
4-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)-1H-pyridazin-6-one (PubChem CID 102888056) has the molecular formula C9H13N3O3S and a molecular weight of 243.29 g/mol. Its IUPAC name is 4-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)-1H-pyridazin-6-one.
| Compound Name | 4-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 102888056 |
| Molecular Formula | C9H13N3O3S |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 4-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)-1H-pyridazin-6-one |
| SMILES | CC1CS(=O)(=O)CCN1c1cn[nH]c(=O)c1 |
| InChI | InChI=1S/C9H13N3O3S/c1-7-6-16(14,15)3-2-12(7)8-4-9(13)11-10-5-8/h4-5,7H,2-3,6H2,1H3,(H,11,13) |
| InChIKey | ISOGOFHNWRGXNN-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |