C13H16FN3O2 — CID 102888114
4-(3-amino-4-fluorobenzoyl)-1-methyl-1,4-diazepan-2-one (PubChem CID 102888114) has the molecular formula C13H16FN3O2 and a molecular weight of 265.29 g/mol. Its IUPAC name is 4-(3-amino-4-fluorobenzoyl)-1-methyl-1,4-diazepan-2-one.
| Compound Name | 4-(3-amino-4-fluorobenzoyl)-1-methyl-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 102888114 |
| Molecular Formula | C13H16FN3O2 |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 4-(3-amino-4-fluorobenzoyl)-1-methyl-1,4-diazepan-2-one |
| SMILES | CN1CCCN(C(=O)c2ccc(F)c(N)c2)CC1=O |
| InChI | InChI=1S/C13H16FN3O2/c1-16-5-2-6-17(8-12(16)18)13(19)9-3-4-10(14)11(15)7-9/h3-4,7H,2,5-6,8,15H2,1H3 |
| InChIKey | NDXQIJNTDHPQSO-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|