C13H19N3O3S — CID 102888192
4-[(2-aminophenyl)methylsulfonyl]-1-methyl-1,4-diazepan-2-one (PubChem CID 102888192) has the molecular formula C13H19N3O3S and a molecular weight of 297.38 g/mol. Its IUPAC name is 4-[(2-aminophenyl)methylsulfonyl]-1-methyl-1,4-diazepan-2-one.
| Compound Name | 4-[(2-aminophenyl)methylsulfonyl]-1-methyl-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 102888192 |
| Molecular Formula | C13H19N3O3S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 4-[(2-aminophenyl)methylsulfonyl]-1-methyl-1,4-diazepan-2-one |
| SMILES | CN1CCCN(S(=O)(=O)Cc2ccccc2N)CC1=O |
| InChI | InChI=1S/C13H19N3O3S/c1-15-7-4-8-16(9-13(15)17)20(18,19)10-11-5-2-3-6-12(11)14/h2-3,5-6H,4,7-10,14H2,1H3 |
| InChIKey | INDAHJWMCXSXRL-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|