C15H21N3O3 — CID 102888503
4-[(6-amino-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-1-methyl-1,4-diazepan-2-one (PubChem CID 102888503) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is 4-[(6-amino-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-1-methyl-1,4-diazepan-2-one.
| Compound Name | 4-[(6-amino-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-1-methyl-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 102888503 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 4-[(6-amino-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-1-methyl-1,4-diazepan-2-one |
| SMILES | CN1CCCN(Cc2cc3c(cc2N)OCCO3)CC1=O |
| InChI | InChI=1S/C15H21N3O3/c1-17-3-2-4-18(10-15(17)19)9-11-7-13-14(8-12(11)16)21-6-5-20-13/h7-8H,2-6,9-10,16H2,1H3 |
| InChIKey | XONIOLGFGDSJQW-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 68.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|