C16H23N3O2 — CID 102888793
4-(2-amino-4-phenylbutanoyl)-1-methyl-1,4-diazepan-2-one (PubChem CID 102888793) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 4-(2-amino-4-phenylbutanoyl)-1-methyl-1,4-diazepan-2-one.
| Compound Name | 4-(2-amino-4-phenylbutanoyl)-1-methyl-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 102888793 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 4-(2-amino-4-phenylbutanoyl)-1-methyl-1,4-diazepan-2-one |
| SMILES | CN1CCCN(C(=O)C(N)CCc2ccccc2)CC1=O |
| InChI | InChI=1S/C16H23N3O2/c1-18-10-5-11-19(12-15(18)20)16(21)14(17)9-8-13-6-3-2-4-7-13/h2-4,6-7,14H,5,8-12,17H2,1H3 |
| InChIKey | RBKOSKVMZCISEI-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |