About 4-[2-(2,3-dihydro-1H-indol-3-yl)acetyl]-1-methyl-1,4-diazepan-2-one
4-[2-(2,3-dihydro-1H-indol-3-yl)acetyl]-1-methyl-1,4-diazepan-2-one (PubChem CID 102888858) has the molecular formula C16H21N3O2
and a molecular weight of 287.36 g/mol. Its IUPAC name is 4-[2-(2,3-dihydro-1H-indol-3-yl)acetyl]-1-methyl-1,4-diazepan-2-one.
Molecular Properties
| Compound Name | 4-[2-(2,3-dihydro-1H-indol-3-yl)acetyl]-1-methyl-1,4-diazepan-2-one |
| PubChem CID | 102888858 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 4-[2-(2,3-dihydro-1H-indol-3-yl)acetyl]-1-methyl-1,4-diazepan-2-one |
| SMILES | CN1CCCN(C(=O)CC2CNc3ccccc32)CC1=O |
| InChI | InChI=1S/C16H21N3O2/c1-18-7-4-8-19(11-16(18)21)15(20)9-12-10-17-14-6-3-2-5-13(12)14/h2-3,5-6,12,17H,4,7-11H2,1H3 |
| InChIKey | NEJGLGUSZVPATN-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[2-(2,3-dihydro-1H-indol-3-yl)acetyl]-1-methyl-1,4-diazepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(2,3-dihydro-1H-indol-3-yl)acetyl]-1-methyl-1,4-diazepan-2-one?
The IUPAC name of 4-[2-(2,3-dihydro-1H-indol-3-yl)acetyl]-1-methyl-1,4-diazepan-2-one (CID 102888858) is 4-[2-(2,3-dihydro-1H-indol-3-yl)acetyl]-1-methyl-1,4-diazepan-2-one.
What is the SMILES notation for 4-[2-(2,3-dihydro-1H-indol-3-yl)acetyl]-1-methyl-1,4-diazepan-2-one?
The canonical SMILES for 4-[2-(2,3-dihydro-1H-indol-3-yl)acetyl]-1-methyl-1,4-diazepan-2-one is CN1CCCN(C(=O)CC2CNc3ccccc32)CC1=O.
What is the InChIKey of 4-[2-(2,3-dihydro-1H-indol-3-yl)acetyl]-1-methyl-1,4-diazepan-2-one?
The InChIKey is NEJGLGUSZVPATN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3O2/c1-18-7-4-8-19(11-16(18)21)15(20)9-12-10-17-14-6-3-2-5-13(12)14/h2-3,5-6,12,17H,4,7-11H2,1H3.
What are the key properties of 4-[2-(2,3-dihydro-1H-indol-3-yl)acetyl]-1-methyl-1,4-diazepan-2-one?
4-[2-(2,3-dihydro-1H-indol-3-yl)acetyl]-1-methyl-1,4-diazepan-2-one has a molecular weight of 287.36 g/mol, XLogP of 1.28, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(2,3-dihydro-1H-indol-3-yl)acetyl]-1-methyl-1,4-diazepan-2-one is sourced from PubChem (CID 102888858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).