C11H21N3OS — CID 102889127
3-(4-methyl-3-oxo-1,4-diazepan-1-yl)pentanethioamide (PubChem CID 102889127) has the molecular formula C11H21N3OS and a molecular weight of 243.38 g/mol. Its IUPAC name is 3-(4-methyl-3-oxo-1,4-diazepan-1-yl)pentanethioamide.
| Compound Name | 3-(4-methyl-3-oxo-1,4-diazepan-1-yl)pentanethioamide |
|---|---|
| PubChem CID | 102889127 |
| Molecular Formula | C11H21N3OS |
| Molecular Weight | 243.38 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 3-(4-methyl-3-oxo-1,4-diazepan-1-yl)pentanethioamide |
| SMILES | CCC(CC(N)=S)N1CCCN(C)C(=O)C1 |
| InChI | InChI=1S/C11H21N3OS/c1-3-9(7-10(12)16)14-6-4-5-13(2)11(15)8-14/h9H,3-8H2,1-2H3,(H2,12,16) |
| InChIKey | HUBLSZFIMKSNEK-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.38 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|