About 3,5-difluoro-4-(4-methyl-3-oxo-1,4-diazepan-1-yl)benzoic acid
3,5-difluoro-4-(4-methyl-3-oxo-1,4-diazepan-1-yl)benzoic acid (PubChem CID 102889224) has the molecular formula C13H14F2N2O3
and a molecular weight of 284.26 g/mol. Its IUPAC name is 3,5-difluoro-4-(4-methyl-3-oxo-1,4-diazepan-1-yl)benzoic acid.
Molecular Properties
| Compound Name | 3,5-difluoro-4-(4-methyl-3-oxo-1,4-diazepan-1-yl)benzoic acid |
| PubChem CID | 102889224 |
| Molecular Formula | C13H14F2N2O3 |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 3,5-difluoro-4-(4-methyl-3-oxo-1,4-diazepan-1-yl)benzoic acid |
| SMILES | CN1CCCN(c2c(F)cc(C(=O)O)cc2F)CC1=O |
| InChI | InChI=1S/C13H14F2N2O3/c1-16-3-2-4-17(7-11(16)18)12-9(14)5-8(13(19)20)6-10(12)15/h5-6H,2-4,7H2,1H3,(H,19,20) |
| InChIKey | KQBHYBOIMADUCJ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,5-difluoro-4-(4-methyl-3-oxo-1,4-diazepan-1-yl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-difluoro-4-(4-methyl-3-oxo-1,4-diazepan-1-yl)benzoic acid?
The IUPAC name of 3,5-difluoro-4-(4-methyl-3-oxo-1,4-diazepan-1-yl)benzoic acid (CID 102889224) is 3,5-difluoro-4-(4-methyl-3-oxo-1,4-diazepan-1-yl)benzoic acid.
What is the SMILES notation for 3,5-difluoro-4-(4-methyl-3-oxo-1,4-diazepan-1-yl)benzoic acid?
The canonical SMILES for 3,5-difluoro-4-(4-methyl-3-oxo-1,4-diazepan-1-yl)benzoic acid is CN1CCCN(c2c(F)cc(C(=O)O)cc2F)CC1=O.
What is the InChIKey of 3,5-difluoro-4-(4-methyl-3-oxo-1,4-diazepan-1-yl)benzoic acid?
The InChIKey is KQBHYBOIMADUCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14F2N2O3/c1-16-3-2-4-17(7-11(16)18)12-9(14)5-8(13(19)20)6-10(12)15/h5-6H,2-4,7H2,1H3,(H,19,20).
What are the key properties of 3,5-difluoro-4-(4-methyl-3-oxo-1,4-diazepan-1-yl)benzoic acid?
3,5-difluoro-4-(4-methyl-3-oxo-1,4-diazepan-1-yl)benzoic acid has a molecular weight of 284.26 g/mol, XLogP of 1.33, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-difluoro-4-(4-methyl-3-oxo-1,4-diazepan-1-yl)benzoic acid is sourced from PubChem (CID 102889224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).