C14H20N2O3 — CID 102889538
4-[3-hydroxy-4-(1-hydroxyethyl)phenyl]-1-methyl-1,4-diazepan-2-one (PubChem CID 102889538) has the molecular formula C14H20N2O3 and a molecular weight of 264.33 g/mol. Its IUPAC name is 4-[3-hydroxy-4-(1-hydroxyethyl)phenyl]-1-methyl-1,4-diazepan-2-one.
| Compound Name | 4-[3-hydroxy-4-(1-hydroxyethyl)phenyl]-1-methyl-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 102889538 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 4-[3-hydroxy-4-(1-hydroxyethyl)phenyl]-1-methyl-1,4-diazepan-2-one |
| SMILES | CC(O)c1ccc(N2CCCN(C)C(=O)C2)cc1O |
| InChI | InChI=1S/C14H20N2O3/c1-10(17)12-5-4-11(8-13(12)18)16-7-3-6-15(2)14(19)9-16/h4-5,8,10,17-18H,3,6-7,9H2,1-2H3 |
| InChIKey | PTFWJKQYDQSUCR-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|