C14H16ClN3O3 — CID 102889556
5-chloro-3-hydroxy-6-(4-methyl-3-oxo-1,4-diazepan-1-yl)-1,3-dihydroindol-2-one (PubChem CID 102889556) has the molecular formula C14H16ClN3O3 and a molecular weight of 309.75 g/mol. Its IUPAC name is 5-chloro-3-hydroxy-6-(4-methyl-3-oxo-1,4-diazepan-1-yl)-1,3-dihydroindol-2-one.
| Compound Name | 5-chloro-3-hydroxy-6-(4-methyl-3-oxo-1,4-diazepan-1-yl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 102889556 |
| Molecular Formula | C14H16ClN3O3 |
| Molecular Weight | 309.75 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 5-chloro-3-hydroxy-6-(4-methyl-3-oxo-1,4-diazepan-1-yl)-1,3-dihydroindol-2-one |
| SMILES | CN1CCCN(c2cc3c(cc2Cl)C(O)C(=O)N3)CC1=O |
| InChI | InChI=1S/C14H16ClN3O3/c1-17-3-2-4-18(7-12(17)19)11-6-10-8(5-9(11)15)13(20)14(21)16-10/h5-6,13,20H,2-4,7H2,1H3,(H,16,21) |
| InChIKey | FANNEIWTGVNATR-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.75 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|