C23H23ClN6O2 — CID 10288963
7-chloro-5-methyl-1-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-3-pyridin-3-ylpyridazino[4,5-b]indol-4-one (PubChem CID 10288963) has the molecular formula C23H23ClN6O2 and a molecular weight of 450.93 g/mol. Its IUPAC name is 7-chloro-5-methyl-1-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-3-pyridin-3-ylpyridazino[4,5-b]indol-4-one.
| Compound Name | 7-chloro-5-methyl-1-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-3-pyridin-3-ylpyridazino[4,5-b]indol-4-one |
|---|---|
| PubChem CID | 10288963 |
| Molecular Formula | C23H23ClN6O2 |
| Molecular Weight | 450.93 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 7-chloro-5-methyl-1-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-3-pyridin-3-ylpyridazino[4,5-b]indol-4-one |
| SMILES | CN1CCN(C(=O)Cc2nn(-c3cccnc3)c(=O)c3c2c2ccc(Cl)cc2n3C)CC1 |
| InChI | InChI=1S/C23H23ClN6O2/c1-27-8-10-29(11-9-27)20(31)13-18-21-17-6-5-15(24)12-19(17)28(2)22(21)23(32)30(26-18)16-4-3-7-25-14-16/h3-7,12,14H,8-11,13H2,1-2H3 |
| InChIKey | SHNVCMQESOSVDN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 76.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.93 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|