C12H17F3N2O3 — CID 102889945
2-[methyl(2,2,2-trifluoroethyl)carbamoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid (PubChem CID 102889945) has the molecular formula C12H17F3N2O3 and a molecular weight of 294.27 g/mol. Its IUPAC name is 2-[methyl(2,2,2-trifluoroethyl)carbamoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid.
| Compound Name | 2-[methyl(2,2,2-trifluoroethyl)carbamoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 102889945 |
| Molecular Formula | C12H17F3N2O3 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 2-[methyl(2,2,2-trifluoroethyl)carbamoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid |
| SMILES | CN(CC(F)(F)F)C(=O)N1CC2CCCC2C1C(=O)O |
| InChI | InChI=1S/C12H17F3N2O3/c1-16(6-12(13,14)15)11(20)17-5-7-3-2-4-8(7)9(17)10(18)19/h7-9H,2-6H2,1H3,(H,18,19) |
| InChIKey | VYCZWUSJTHNRDA-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |