C29H35FN4O2 — CID 10289026
6-(3-ethyl-4-methylanilino)-3-[5-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]pentyl]-1H-pyrimidine-2,4-dione (PubChem CID 10289026) has the molecular formula C29H35FN4O2 and a molecular weight of 490.62 g/mol. Its IUPAC name is 6-(3-ethyl-4-methylanilino)-3-[5-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]pentyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-(3-ethyl-4-methylanilino)-3-[5-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]pentyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10289026 |
| Molecular Formula | C29H35FN4O2 |
| Molecular Weight | 490.62 g/mol |
| Exact Mass | 490.27 |
| IUPAC Name | 6-(3-ethyl-4-methylanilino)-3-[5-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]pentyl]-1H-pyrimidine-2,4-dione |
| SMILES | CCc1cc(Nc2cc(=O)n(CCCCCN3CC=C(c4ccc(F)cc4)CC3)c(=O)[nH]2)ccc1C |
| InChI | InChI=1S/C29H35FN4O2/c1-3-22-19-26(12-7-21(22)2)31-27-20-28(35)34(29(36)32-27)16-6-4-5-15-33-17-13-24(14-18-33)23-8-10-25(30)11-9-23/h7-13,19-20,31H,3-6,14-18H2,1-2H3,(H,32,36) |
| InChIKey | YTDGKAKXSJZKPA-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 70.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.62 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|