C15H16INO3 — CID 102890595
2-(3-iodobenzoyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid (PubChem CID 102890595) has the molecular formula C15H16INO3 and a molecular weight of 385.20 g/mol. Its IUPAC name is 2-(3-iodobenzoyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid.
| Compound Name | 2-(3-iodobenzoyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 102890595 |
| Molecular Formula | C15H16INO3 |
| Molecular Weight | 385.20 g/mol |
| Exact Mass | 385.02 |
| IUPAC Name | 2-(3-iodobenzoyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid |
| SMILES | O=C(O)C1C2CCCC2CN1C(=O)c1cccc(I)c1 |
| InChI | InChI=1S/C15H16INO3/c16-11-5-1-3-9(7-11)14(18)17-8-10-4-2-6-12(10)13(17)15(19)20/h1,3,5,7,10,12-13H,2,4,6,8H2,(H,19,20) |
| InChIKey | ZJNNWUKTIKMLEO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.20 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|